EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22ClN7O3 |
| Net Charge | 0 |
| Average Mass | 431.884 |
| Monoisotopic Mass | 431.14727 |
| SMILES | C=CC(=O)N1C[C@H](COc2nc(Nc3cnn(C)c3)nc3ncc(Cl)c23)[C@@H](OC)C1 |
| InChI | InChI=1S/C19H22ClN7O3/c1-4-15(28)27-7-11(14(9-27)29-3)10-30-18-16-13(20)6-21-17(16)24-19(25-18)23-12-5-22-26(2)8-12/h4-6,8,11,14H,1,7,9-10H2,2-3H3,(H2,21,23,24,25)/t11-,14+/m1/s1 |
| InChIKey | ODMXWZROLKITMS-RISCZKNCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-06459988 (CHEBI:755881) has role antineoplastic agent (CHEBI:35610) |
| pf-06459988 (CHEBI:755881) is a pyrrolopyrimidine (CHEBI:38670) |
| Synonym | Source |
|---|---|
| PF-06459988 | ChEMBL |
| Citations |
|---|