EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755880 - lp-184
| Formula | C16H20N2O4 |
| Net Charge | 0 |
| Average Mass | 304.346 |
| Monoisotopic Mass | 304.14231 |
| SMILES | CC1=C(CN(O)C(N)=O)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1 |
| InChI | InChI=1S/C16H20N2O4/c1-8-6-10-12(11(8)7-18(22)14(17)20)9(2)16(4-5-16)15(3,21)13(10)19/h6,21-22H,4-5,7H2,1-3H3,(H2,17,20)/t15-/m0/s1 |
| InChIKey | VWMPVAZEBAKLFR-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lp-184 (CHEBI:755880) has role antineoplastic agent (CHEBI:35610) |
| lp-184 (CHEBI:755880) is a cyclohexenones (CHEBI:48953) |
| Synonyms | Source |
|---|---|
| (-)-hydroxyurea methylacylfulvene | ChEMBL |
| Hydroxyurea methylacylfulvene | ChEMBL |
| Lp-184 | ChEMBL |
| LP184 | ChEMBL |
| Citations |
|---|