EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H26FN7O |
| Net Charge | 0 |
| Average Mass | 507.573 |
| Monoisotopic Mass | 507.21829 |
| SMILES | [H][C@@]12CCC[C@]1([H])N1C(=N2)N(C)C(=O)c2c1nn(Cc1ccc(-c3cccc(F)n3)cc1)c2Nc1ccccc1 |
| InChI | InChI=1S/C29H26FN7O/c1-35-28(38)25-26(31-20-7-3-2-4-8-20)36(34-27(25)37-23-11-5-10-22(23)33-29(35)37)17-18-13-15-19(16-14-18)21-9-6-12-24(30)32-21/h2-4,6-9,12-16,22-23,31H,5,10-11,17H2,1H3/t22-,23+/m1/s1 |
| InChIKey | BBIPVJCGIASXJB-PKTZIBPZSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antiparkinson drug A drug used in the treatment of Parkinson's disease. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenrispodun (CHEBI:755877) has role antiparkinson drug (CHEBI:48407) |
| lenrispodun (CHEBI:755877) has role antipsychotic agent (CHEBI:35476) |
| lenrispodun (CHEBI:755877) has role cardiovascular drug (CHEBI:35554) |
| lenrispodun (CHEBI:755877) is a pyrazolopyrimidine (CHEBI:38669) |
| INN | Source |
|---|---|
| lenrispodun | WHO MedNet |
| Synonyms | Source |
|---|---|
| IC-200214 | ChEMBL |
| IC200214 | ChEMBL |
| ITI-214 | ChEMBL |
| ITI-214F | ChEMBL |
| Iti-214 free base | ChEMBL |
| Citations |
|---|