EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H16N6 |
| Net Charge | 0 |
| Average Mass | 388.434 |
| Monoisotopic Mass | 388.14364 |
| SMILES | c1cc(-c2nc3ccc(-c4ccc5nc(-c6ccncc6)nc5c4)cc3n2)ccn1 |
| InChI | InChI=1S/C24H16N6/c1-3-19-21(29-23(27-19)15-5-9-25-10-6-15)13-17(1)18-2-4-20-22(14-18)30-24(28-20)16-7-11-26-12-8-16/h1-14H,(H,27,29)(H,28,30) |
| InChIKey | UHQFBTAJFNVZIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ridinilazole (CHEBI:755873) has role antibacterial agent (CHEBI:33282) |
| ridinilazole (CHEBI:755873) has role antiinfective agent (CHEBI:35441) |
| ridinilazole (CHEBI:755873) is a benzimidazoles (CHEBI:22715) |
| INNs | Source |
|---|---|
| ridinilazol | WHO MedNet |
| ridinilazole | WHO MedNet |
| Synonyms | Source |
|---|---|
| SMT-19969 | ChEMBL |
| SMT19969 | ChEMBL |
| Citations |
|---|