EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27Cl2N3O4 |
| Net Charge | 0 |
| Average Mass | 540.447 |
| Monoisotopic Mass | 539.13786 |
| SMILES | Cn1cc(C(=O)O)c2ccc(N3CCC(OCc4c(-c5c(Cl)cccc5Cl)noc4C4CC4)CC3)cc21 |
| InChI | InChI=1S/C28H27Cl2N3O4/c1-32-14-20(28(34)35)19-8-7-17(13-24(19)32)33-11-9-18(10-12-33)36-15-21-26(31-37-27(21)16-5-6-16)25-22(29)3-2-4-23(25)30/h2-4,7-8,13-14,16,18H,5-6,9-12,15H2,1H3,(H,34,35) |
| InChIKey | RPVDFHPBGBMWID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tern-101 (CHEBI:755872) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| LY-2562175 | ChEMBL |
| LY2562175 | ChEMBL |
| TERN-101 | ChEMBL |
| Citations |
|---|