EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12BrNO2S |
| Net Charge | 0 |
| Average Mass | 338.226 |
| Monoisotopic Mass | 336.97721 |
| SMILES | O=C(O)C1(Sc2ccnc3ccc(Br)cc23)CCC1 |
| InChI | InChI=1S/C14H12BrNO2S/c15-9-2-3-11-10(8-9)12(4-7-16-11)19-14(13(17)18)5-1-6-14/h2-4,7-8H,1,5-6H2,(H,17,18) |
| InChIKey | QGBWIYLNOBYNDL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| shr-4640 (CHEBI:755871) has role gout suppressant (CHEBI:35845) |
| shr-4640 (CHEBI:755871) is a organohalogen compound (CHEBI:17792) |
| shr-4640 (CHEBI:755871) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| ruzinurad | WHO MedNet |
| Synonyms | Source |
|---|---|
| SHR-4640 | ChEMBL |
| SHR4640 | ChEMBL |
| Citations |
|---|