EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C21H25O10P.Na |
| Net Charge | 0 |
| Average Mass | 514.375 |
| Monoisotopic Mass | 514.09807 |
| SMILES | [H][C@@]12O[C@@]13[C@@]1(C)CCC4=C(COC4=O)[C@]1([H])C[C@]1([H])O[C@]31[C@H](OCOP(=O)([O-])[O-])[C@@]1(C(C)C)O[C@@]21[H].[Na+].[Na+] |
| InChI | InChI=1S/C21H27O10P.2Na/c1-9(2)19-14(30-19)15-21(31-15)18(3)5-4-10-11(7-26-16(10)22)12(18)6-13-20(21,29-13)17(19)27-8-28-32(23,24)25;;/h9,12-15,17H,4-8H2,1-3H3,(H2,23,24,25);;/q;2*+1/p-2/t12-,13-,14-,15-,17+,18-,19-,20+,21+;;/m0../s1 |
| InChIKey | ZHBJMVNZRZUQEP-KIKMAQITSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minnelide (CHEBI:755869) has role antineoplastic agent (CHEBI:35610) |
| minnelide (CHEBI:755869) is a oxacycle (CHEBI:38104) |
| Synonym | Source |
|---|---|
| Minnelide | ChEMBL |
| Citations |
|---|