EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H23N5O5S2 |
| Net Charge | 0 |
| Average Mass | 561.645 |
| Monoisotopic Mass | 561.11406 |
| SMILES | COc1cc(OCc2csc(-c3ccc(C(=O)N(C)C)cc3)n2)c2cc(-c3cn4nc(OC)sc4n3)oc2c1 |
| InChI | InChI=1S/C27H23N5O5S2/c1-31(2)25(33)16-7-5-15(6-8-16)24-28-17(14-38-24)13-36-21-9-18(34-3)10-22-19(21)11-23(37-22)20-12-32-26(29-20)39-27(30-32)35-4/h5-12,14H,13H2,1-4H3 |
| InChIKey | KEEBLYWBELVGPQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-986141 (CHEBI:755865) has role anticoagulant (CHEBI:50249) |
| bms-986141 (CHEBI:755865) has role cardiovascular drug (CHEBI:35554) |
| bms-986141 (CHEBI:755865) is a benzofurans (CHEBI:35259) |
| Synonyms | Source |
|---|---|
| BMS-986141 | ChEMBL |
| UDM-003183 | ChEMBL |
| Citations |
|---|