EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N5O4S |
| Net Charge | 0 |
| Average Mass | 353.404 |
| Monoisotopic Mass | 353.11578 |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(N)nc2N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H19N5O4S/c1-7(2)8-4-10(22-3)12(24(17,20)21)5-9(8)23-11-6-18-14(16)19-13(11)15/h4-7H,1-3H3,(H2,17,20,21)(H4,15,16,18,19) |
| InChIKey | HLWURFKMDLAKOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. anti-inflammatory agent Any compound that has anti-inflammatory effects. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gefapixant (CHEBI:755863) has role anti-asthmatic agent (CHEBI:65023) |
| gefapixant (CHEBI:755863) has role anti-inflammatory agent (CHEBI:67079) |
| gefapixant (CHEBI:755863) has role antifibrotic agent (CHEBI:233423) |
| gefapixant (CHEBI:755863) has role antitussive (CHEBI:51177) |
| gefapixant (CHEBI:755863) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| AF-219 | ChEMBL |
| Gefapixant | ChEMBL |
| R-1646 | ChEMBL |
| R1646 | ChEMBL |
| RG-1646 | ChEMBL |
| RG1646 | ChEMBL |
| Citations |
|---|