EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CNS.C6H12N4.CNS.Ca |
| Net Charge | 0 |
| Average Mass | 296.438 |
| Monoisotopic Mass | 296.01908 |
| SMILES | C1N2CN3CN1CN(C2)C3.N#C[S-].N#C[S-].[Ca+2] |
| InChI | InChI=1S/C6H12N4.2CHNS.Ca/c1-7-2-9-4-8(1)5-10(3-7)6-9;2*2-1-3;/h1-6H2;2*3H;/q;;;+2/p-2 |
| InChIKey | MYCYALXPHWPBMJ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcium hexamine thiocyanate (CHEBI:755862) has role nasal decongestant (CHEBI:77715) |
| calcium hexamine thiocyanate (CHEBI:755862) is a 1,3,5-triazinanes (CHEBI:38779) |
| Synonym | Source |
|---|---|
| Calcium hexamine thiocyanate | ChEMBL |