EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H47NO4 |
| Net Charge | 0 |
| Average Mass | 533.753 |
| Monoisotopic Mass | 533.35051 |
| SMILES | CCCCc1oc2ccc(C(=O)OC(C)C)cc2c1C(=O)c1ccc(CCCN(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C34H47NO4/c1-6-9-14-31-32(29-24-28(19-20-30(29)39-31)34(37)38-25(4)5)33(36)27-17-15-26(16-18-27)13-12-23-35(21-10-7-2)22-11-8-3/h15-20,24-25H,6-14,21-23H2,1-5H3 |
| InChIKey | ZCENNVQCOZQSGH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celivarone (CHEBI:755854) has role anti-arrhythmia drug (CHEBI:38070) |
| celivarone (CHEBI:755854) is a aromatic ketone (CHEBI:76224) |
| INNs | Source |
|---|---|
| celivarona | WHO MedNet |
| celivarone | WHO MedNet |
| Synonyms | Source |
|---|---|
| K45001587E | ChEMBL |
| Ssr149744 | ChEMBL |
| SSR149744C | ChEMBL |
| UNII-K45001587E | ChEMBL |