EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16F3N3O3 |
| Net Charge | 0 |
| Average Mass | 415.371 |
| Monoisotopic Mass | 415.11438 |
| SMILES | O=C1c2cc(-c3ccc(OC(F)(F)F)cc3)ccc2OCCN1Cc1ncccn1 |
| InChI | InChI=1S/C21H16F3N3O3/c22-21(23,24)30-16-5-2-14(3-6-16)15-4-7-18-17(12-15)20(28)27(10-11-29-18)13-19-25-8-1-9-26-19/h1-9,12H,10-11,13H2 |
| InChIKey | YNUAEEJQYHYLMS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eleclazine (CHEBI:755845) has role anti-arrhythmia drug (CHEBI:38070) |
| eleclazine (CHEBI:755845) has role cardiovascular drug (CHEBI:35554) |
| eleclazine (CHEBI:755845) is a aromatic ether (CHEBI:35618) |
| INNs | Source |
|---|---|
| eleclazina | WHO MedNet |
| eleclazine | WHO MedNet |
| Synonym | Source |
|---|---|
| GS-6615 | ChEMBL |
| Citations |
|---|