EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H58F2N6O9S |
| Net Charge | 0 |
| Average Mass | 861.022 |
| Monoisotopic Mass | 860.39540 |
| SMILES | [H][C@]12CCCCC(F)(F)c3nc4ccc(OC)cc4nc3O[C@@]3([H])CN(C(=O)[C@]([H])(C(C)(C)C)NC(=O)O[C@]1([H])C2)[C@H](C(=O)N[C@]1(C(=O)NS(=O)(=O)C2(C)CC2)C[C@@]1([H])C(C)C)[C@@H]3CC |
| InChI | InChI=1S/C42H58F2N6O9S/c1-9-25-30-21-50(31(25)34(51)48-41(20-26(41)22(2)3)37(53)49-60(55,56)40(7)16-17-40)36(52)33(39(4,5)6)47-38(54)59-29-18-23(29)12-10-11-15-42(43,44)32-35(58-30)46-28-19-24(57-8)13-14-27(28)45-32/h13-14,19,22-23,25-26,29-31,33H,9-12,15-18,20-21H2,1-8H3,(H,47,54)(H,48,51)(H,49,53)/t23-,25-,26+,29-,30+,31+,33-,41-/m1/s1 |
| InChIKey | MKDALIOACIEUJM-XCFCBFDASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| voxilaprevir (CHEBI:755830) has role antiviral agent (CHEBI:22587) |
| voxilaprevir (CHEBI:755830) is a cyclic peptide (CHEBI:23449) |
| Synonyms | Source |
|---|---|
| GS-9857 | ChEMBL |
| Voxilaprevir | ChEMBL |
| Brand Name | Source |
|---|---|
| Voxilaprevir component of vosevi | ChEMBL |