EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755827 - indolapril hydrochloride
| Formula | HCl.C24H34N2O5 |
| Net Charge | 0 |
| Average Mass | 467.006 |
| Monoisotopic Mass | 466.22345 |
| SMILES | Cl.[H][C@@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)OCC)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C24H34N2O5.ClH/c1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29;/h4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29);1H/t16-,18-,19-,20-,21-;/m0./s1 |
| InChIKey | QNSWMJYOGMUVGO-PABIKWFMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indolapril hydrochloride (CHEBI:755827) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| CI-907 | ChEMBL |
| Indolapril hydrochloride | ChEMBL |