EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36F3NO4 |
| Net Charge | 0 |
| Average Mass | 555.637 |
| Monoisotopic Mass | 555.25964 |
| SMILES | Cc1cc(O[C@@H](CCC(F)(F)F)c2ccc(C(=O)NCCC(=O)O)cc2)cc(C)c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H36F3NO4/c1-20-18-26(19-21(2)29(20)23-10-12-25(13-11-23)31(3,4)5)40-27(14-16-32(33,34)35)22-6-8-24(9-7-22)30(39)36-17-15-28(37)38/h6-13,18-19,27H,14-17H2,1-5H3,(H,36,39)(H,37,38)/t27-/m0/s1 |
| InChIKey | FASLTMSUPQDLIB-MHZLTWQESA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adomeglivant (CHEBI:755818) has functional parent β-amino acid (CHEBI:33706) |
| adomeglivant (CHEBI:755818) has role hypoglycemic agent (CHEBI:35526) |
| adomeglivant (CHEBI:755818) has role renoprotective agent (CHEBI:231911) |
| adomeglivant (CHEBI:755818) is a organonitrogen compound (CHEBI:35352) |
| adomeglivant (CHEBI:755818) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| adomeglivant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Adomeglivant, (-)- | ChEMBL |
| LY-2409021 | ChEMBL |
| LY2409021 | ChEMBL |
| Citations |
|---|