EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H33N5O2S |
| Net Charge | 0 |
| Average Mass | 539.705 |
| Monoisotopic Mass | 539.23550 |
| SMILES | CCN(CC)CCNC(=O)c1c(C)nc(/C=C2\C(=O)Nc3ccc(-c4csc(-c5ccccc5)n4)cc32)c1C |
| InChI | InChI=1S/C31H33N5O2S/c1-5-36(6-2)15-14-32-30(38)28-19(3)26(33-20(28)4)17-24-23-16-22(12-13-25(23)34-29(24)37)27-18-39-31(35-27)21-10-8-7-9-11-21/h7-13,16-18,33H,5-6,14-15H2,1-4H3,(H,32,38)(H,34,37)/b24-17- |
| InChIKey | QDWKGEFGLQMDAM-ULJHMMPZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amcasertib (CHEBI:755816) has role antineoplastic agent (CHEBI:35610) |
| amcasertib (CHEBI:755816) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| amcasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BBI-503 | ChEMBL |
| BBI503 | ChEMBL |