EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2O2S |
| Net Charge | 0 |
| Average Mass | 348.427 |
| Monoisotopic Mass | 348.09325 |
| SMILES | CC(C)(Sc1ccncc1-c1ccc(C#N)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H16N2O2S/c1-20(2,19(23)24)25-18-9-10-22-12-17(18)16-8-7-13(11-21)14-5-3-4-6-15(14)16/h3-10,12H,1-2H3,(H,23,24) |
| InChIKey | YYBOLPLTQDKXPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| verinurad (CHEBI:755815) has role cardiovascular drug (CHEBI:35554) |
| verinurad (CHEBI:755815) has role gout suppressant (CHEBI:35845) |
| verinurad (CHEBI:755815) is a naphthalenes (CHEBI:25477) |
| INN | Source |
|---|---|
| verinurad | WHO MedNet |
| Synonyms | Source |
|---|---|
| RDEA-3170 | ChEMBL |
| RDEA3170 | ChEMBL |
| Citations |
|---|