EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Mg.C8H9NO6P.C5H9N2O3 |
| Net Charge | 0 |
| Average Mass | 415.578 |
| Monoisotopic Mass | 415.06311 |
| SMILES | Cc1ncc(COP(=O)([O-])O)c(C=O)c1O.NC(=O)CC[C@H](N)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C8H10NO6P.C5H10N2O3.Mg/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;6-3(5(9)10)1-2-4(7)8;/h2-3,11H,4H2,1H3,(H2,12,13,14);3H,1-2,6H2,(H2,7,8)(H,9,10);/q;;+2/p-2/t;3-;/m.0./s1 |
| InChIKey | HFAKVRNAKYBCSN-RJXKWAGSSA-L |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium pyridoxal 5-phosphate glutamate (CHEBI:755808) has role cardiovascular drug (CHEBI:35554) |
| magnesium pyridoxal 5-phosphate glutamate (CHEBI:755808) is a glutamine derivative (CHEBI:70813) |
| Synonym | Source |
|---|---|
| Magnesium pyridoxal 5-phosphate glutamate | ChEMBL |