EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33NO4 |
| Net Charge | 0 |
| Average Mass | 459.586 |
| Monoisotopic Mass | 459.24096 |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCO)ccc1N1CCCC1 |
| InChI | InChI=1S/C29H33NO4/c1-29(2,3)25-19-23(10-12-26(25)30-14-4-5-15-30)24-18-22(11-13-27(24)34-17-16-31)20-6-8-21(9-7-20)28(32)33/h6-13,18-19,31H,4-5,14-17H2,1-3H3,(H,32,33) |
| InChIKey | MFBCDACCJCDGBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trifarotene (CHEBI:755791) has role antineoplastic agent (CHEBI:35610) |
| trifarotene (CHEBI:755791) is a pyrrolidines (CHEBI:38260) |
| INN | Source |
|---|---|
| trifaroteno | WHO MedNet |
| Synonyms | Source |
|---|---|
| CD-5789 | ChEMBL |
| CD5789 | ChEMBL |
| Trifarotene | ChEMBL |
| Brand Name | Source |
|---|---|
| Aklief | ChEMBL |
| Citations |
|---|