EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755788 - strontium ranelate
| Formula | C12H6N2O8S.Sr.Sr |
| Net Charge | 0 |
| Average Mass | 513.493 |
| Monoisotopic Mass | 513.79571 |
| SMILES | N#Cc1c(N(CC(=O)[O-])CC(=O)[O-])sc(C(=O)[O-])c1CC(=O)[O-].[Sr+2].[Sr+2] |
| InChI | InChI=1S/C12H10N2O8S.2Sr/c13-2-6-5(1-7(15)16)10(12(21)22)23-11(6)14(3-8(17)18)4-9(19)20;;/h1,3-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22);;/q;2*+2/p-4 |
| InChIKey | XXUZFRDUEGQHOV-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strontium ranelate (CHEBI:755788) has functional parent tetracarboxylic acid (CHEBI:35742) |
| strontium ranelate (CHEBI:755788) has role bone density conservation agent (CHEBI:50646) |
| strontium ranelate (CHEBI:755788) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| Distrontium renelate | ChEMBL |
| Osseor | ChEMBL |
| Ranelic acid strontium salt | ChEMBL |
| Strontium ranelate | ChEMBL |
| Strontium ranelate anhydrous | ChEMBL |
| Strontium ranelate nonahydrate | ChEMBL |
| Brand Name | Source |
|---|---|
| Protelos | ChEMBL |
| Citations |
|---|