EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755786 - magnesium pidolate
| Formula | C5H6NO3.Mg.C5H6NO3 |
| Net Charge | 0 |
| Average Mass | 280.519 |
| Monoisotopic Mass | 280.05458 |
| SMILES | O=C([O-])[C@@H]1CCC(O)=N1.O=C([O-])[C@@H]1CCC(O)=N1.[Mg+2] |
| InChI | InChI=1S/2C5H7NO3.Mg/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2/t2*3-;/m00./s1 |
| InChIKey | JQAACYUZYRBHGG-QHTZZOMLSA-L |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium pidolate (CHEBI:755786) has role anti-anaemic agent (CHEBI:75835) |
| magnesium pidolate (CHEBI:755786) has role anti-inflammatory agent (CHEBI:67079) |
| magnesium pidolate (CHEBI:755786) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Magnesium pca | ChEMBL |
| Magnesium pidolate | ChEMBL |
| Magnesium pyroglutamate | ChEMBL |
| Pidolic acid magnesium salt (2:1) | ChEMBL |
| Citations |
|---|