EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11NO3.C6H13AlO9 |
| Net Charge | 0 |
| Average Mass | 377.279 |
| Monoisotopic Mass | 377.11139 |
| SMILES | NC(CO)(CO)CO.O=C([O][Al]([OH])[OH])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O7.C4H11NO3.Al.2H2O/c7-1-2(8)3(9)4(10)5(11)6(12)13;5-4(1-6,2-7)3-8;;;/h2-5,7-11H,1H2,(H,12,13);6-8H,1-3,5H2;;2*1H2/q;;+3;;/p-3/t2-,3-,4+,5-;;;;/m1..../s1 |
| InChIKey | GJJYZOBRHIMORS-GQOAHPRESA-K |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aloglutamol (CHEBI:755784) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| Aloglutamol | ChEMBL |
| Altris | ChEMBL |
| Pyreses | ChEMBL |
| Sabro | ChEMBL |
| Tasto | ChEMBL |