EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.Li.Li |
| Net Charge | 0 |
| Average Mass | 129.954 |
| Monoisotopic Mass | 130.04297 |
| SMILES | O=C([O-])CCC(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C4H6O4.2Li/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);;/q;2*+1/p-2 |
| InChIKey | WAHQBNXSPALNEA-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lithium succinate (CHEBI:755776) is a dicarboxylic acid (CHEBI:35692) |
| Synonym | Source |
|---|---|
| Lithium succinate | ChEMBL |