EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8N4O5 |
| Net Charge | 0 |
| Average Mass | 264.197 |
| Monoisotopic Mass | 264.04947 |
| SMILES | O=C1CN(/N=C/C=C/c2ccc([N+](=O)[O-])o2)C(=O)N1 |
| InChI | InChI=1S/C10H8N4O5/c15-8-6-13(10(16)12-8)11-5-1-2-7-3-4-9(19-7)14(17)18/h1-5H,6H2,(H,12,15,16)/b2-1+,11-5+ |
| InChIKey | DECBQELQORZLLP-UAIOPKHMSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furazidin (CHEBI:755756) has role antibacterial agent (CHEBI:33282) |
| furazidin (CHEBI:755756) is a imidazolidine-2,4-dione (CHEBI:24628) |
| Synonym | Source |
|---|---|
| Furaginum | ChEMBL |
| Citations |
|---|