EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO6 |
| Net Charge | 0 |
| Average Mass | 323.345 |
| Monoisotopic Mass | 323.13689 |
| SMILES | COC(=O)c1ccc(OC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C16H21NO6/c1-22-16(20)12-8-10-13(11-9-12)23-15(19)7-5-3-2-4-6-14(18)17-21/h8-11,21H,2-7H2,1H3,(H,17,18) |
| InChIKey | XDZAHHULFQIBFE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remetinostat (CHEBI:755733) has role antineoplastic agent (CHEBI:35610) |
| remetinostat (CHEBI:755733) is a benzoate ester (CHEBI:36054) |
| INN | Source |
|---|---|
| remetinostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-748492 | ChEMBL |
| SHP-141 | ChEMBL |