EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O4.C17H21NO |
| Net Charge | 0 |
| Average Mass | 493.564 |
| Monoisotopic Mass | 493.23252 |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccccc1.Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O |
| InChI | InChI=1S/C17H21NO.C9H10N4O4/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15/h3-12,17H,13-14H2,1-2H3;4H,3H2,1-2H3,(H,14,15) |
| InChIKey | UFKLOBYBVCBTBP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etanautine (CHEBI:755730) has role antiparkinson drug (CHEBI:48407) |
| etanautine (CHEBI:755730) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Diphenhydramine monoacefyllinate | ChEMBL |
| Etanautine | ChEMBL |