EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H40FN9O3 |
| Net Charge | 0 |
| Average Mass | 665.774 |
| Monoisotopic Mass | 665.32381 |
| SMILES | CC(C)(/C=C(\C#N)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3F)c3c(N)ncnc32)C1)N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C36H40FN9O3/c1-36(2,45-15-13-43(14-16-45)26-21-48-22-26)18-24(19-38)35(47)44-12-6-7-25(20-44)46-34-31(33(39)40-23-41-34)32(42-46)29-11-10-28(17-30(29)37)49-27-8-4-3-5-9-27/h3-5,8-11,17-18,23,25-26H,6-7,12-16,20-22H2,1-2H3,(H2,39,40,41)/b24-18+/t25-/m1/s1 |
| InChIKey | LCFFREMLXLZNHE-GBOLQPHISA-N |
| Roles Classification |
|---|
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rilzabrutinib (CHEBI:755717) has role anti-anaemic agent (CHEBI:75835) |
| rilzabrutinib (CHEBI:755717) has role anti-asthmatic agent (CHEBI:65023) |
| rilzabrutinib (CHEBI:755717) has role anti-inflammatory agent (CHEBI:67079) |
| rilzabrutinib (CHEBI:755717) has role dermatologic drug (CHEBI:50177) |
| rilzabrutinib (CHEBI:755717) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| rilzabrutinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Prn-1008 | ChEMBL |
| PRN1008 | ChEMBL |
| Rilzabrutinib, (.alpha.e,3s)- | ChEMBL |
| Citations |
|---|