EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N6O3 |
| Net Charge | 0 |
| Average Mass | 418.457 |
| Monoisotopic Mass | 418.17534 |
| SMILES | C=CC(=O)N1CC[C@H](n2nc(C#Cc3cc(OC)cc(OC)c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C22H22N6O3/c1-4-19(29)27-8-7-15(12-27)28-22-20(21(23)24-13-25-22)18(26-28)6-5-14-9-16(30-2)11-17(10-14)31-3/h4,9-11,13,15H,1,7-8,12H2,2-3H3,(H2,23,24,25)/t15-/m0/s1 |
| InChIKey | KEIPNCCJPRMIAX-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| futibatinib (CHEBI:755715) has role antineoplastic agent (CHEBI:35610) |
| futibatinib (CHEBI:755715) is a dimethoxybenzene (CHEBI:51681) |
| Synonyms | Source |
|---|---|
| Fgfr-in-1 | ChEMBL |
| Futibatinib | ChEMBL |
| Tas 120 | ChEMBL |
| TAS-120 | ChEMBL |
| Brand Name | Source |
|---|---|
| Lytgobi | ChEMBL |
| Citations |
|---|