EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29N5O3 |
| Net Charge | 0 |
| Average Mass | 375.473 |
| Monoisotopic Mass | 375.22704 |
| SMILES | Cn1nc(N2CCC(OC(=O)N3CCN(C4CCC4)CC3)CC2)ccc1=O |
| InChI | InChI=1S/C19H29N5O3/c1-21-18(25)6-5-17(20-21)23-9-7-16(8-10-23)27-19(26)24-13-11-22(12-14-24)15-3-2-4-15/h5-6,15-16H,2-4,7-14H2,1H3 |
| InChIKey | BVUJMFFRMZRNAT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lml-134 (CHEBI:755714) is a piperazinecarboxylic acid (CHEBI:48683) |
| Synonyms | Source |
|---|---|
| Lml-134 | ChEMBL |
| Lml134 | ChEMBL |
| Citations |
|---|