EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16F3N3O3 |
| Net Charge | 0 |
| Average Mass | 391.349 |
| Monoisotopic Mass | 391.11438 |
| SMILES | Cc1cc(Oc2ncccc2C(F)(F)F)ccc1-c1c(C)c(=O)nc(=O)n1C |
| InChI | InChI=1S/C19H16F3N3O3/c1-10-9-12(28-17-14(19(20,21)22)5-4-8-23-17)6-7-13(10)15-11(2)16(26)24-18(27)25(15)3/h4-9H,1-3H3,(H,24,26,27) |
| InChIKey | AKQXQLUNFKDZBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tavapadon (CHEBI:755713) has role antiparkinson drug (CHEBI:48407) |
| tavapadon (CHEBI:755713) has role renoprotective agent (CHEBI:231911) |
| tavapadon (CHEBI:755713) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| tavapadon | WHO MedNet |
| Synonyms | Source |
|---|---|
| CVL-751 | ChEMBL |
| PF-06649751 | ChEMBL |
| Citations |
|---|