EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N2O6 |
| Net Charge | 0 |
| Average Mass | 466.534 |
| Monoisotopic Mass | 466.21039 |
| SMILES | Cc1c([C@@H](O)CN2CCN(C[C@H](O)c3ccc4c(c3C)COC4=O)CC2)ccc2c1COC2=O |
| InChI | InChI=1S/C26H30N2O6/c1-15-17(3-5-19-21(15)13-33-25(19)31)23(29)11-27-7-9-28(10-8-27)12-24(30)18-4-6-20-22(16(18)2)14-34-26(20)32/h3-6,23-24,29-30H,7-14H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | OCKGFTQIICXDQW-ZEQRLZLVSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-7145 (CHEBI:755711) has role antihypertensive agent (CHEBI:35674) |
| mk-7145 (CHEBI:755711) is a 2-benzofurans (CHEBI:38831) |
| Synonym | Source |
|---|---|
| Mk-7145 | ChEMBL |
| Citations |
|---|