EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H36N6O4 |
| Net Charge | 0 |
| Average Mass | 592.700 |
| Monoisotopic Mass | 592.27980 |
| SMILES | COCC(=O)Nc1cc(COc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)c3ccccc23)ccn1 |
| InChI | InChI=1S/C34H36N6O4/c1-22-10-12-24(13-11-22)40-31(19-29(39-40)34(2,3)4)38-33(42)36-27-14-15-28(26-9-7-6-8-25(26)27)44-20-23-16-17-35-30(18-23)37-32(41)21-43-5/h6-19H,20-21H2,1-5H3,(H,35,37,41)(H2,36,38,42) |
| InChIKey | RTDCVLCTBQDLBW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-49095397 (CHEBI:755710) has role antiviral agent (CHEBI:22587) |
| jnj-49095397 (CHEBI:755710) is a pyrazoles (CHEBI:26410) |
| jnj-49095397 (CHEBI:755710) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| JNJ-49095397 | ChEMBL |
| RV-568 | ChEMBL |
| RV568 | ChEMBL |
| Citations |
|---|