EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8BrN7 |
| Net Charge | 0 |
| Average Mass | 306.127 |
| Monoisotopic Mass | 305.00246 |
| SMILES | Nc1nc(-n2cccn2)nc(-n2cccn2)c1Br |
| InChI | InChI=1S/C10H8BrN7/c11-7-8(12)15-10(18-6-2-4-14-18)16-9(7)17-5-1-3-13-17/h1-6H,(H2,12,15,16) |
| InChIKey | ATFXVNUWQOXRRU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pbf-509 (CHEBI:755709) has role antineoplastic agent (CHEBI:35610) |
| pbf-509 (CHEBI:755709) has role antiparkinson drug (CHEBI:48407) |
| pbf-509 (CHEBI:755709) is a organohalogen compound (CHEBI:17792) |
| pbf-509 (CHEBI:755709) is a pyrimidines (CHEBI:39447) |
| Synonym | Source |
|---|---|
| Pbf-509 | ChEMBL |
| Citations |
|---|