EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755707 - citarinostat
| Formula | C24H26ClN5O3 |
| Net Charge | 0 |
| Average Mass | 467.957 |
| Monoisotopic Mass | 467.17242 |
| SMILES | O=C(CCCCCCNC(=O)c1cnc(N(c2ccccc2)c2ccccc2Cl)nc1)NO |
| InChI | InChI=1S/C24H26ClN5O3/c25-20-12-7-8-13-21(20)30(19-10-4-3-5-11-19)24-27-16-18(17-28-24)23(32)26-15-9-2-1-6-14-22(31)29-33/h3-5,7-8,10-13,16-17,33H,1-2,6,9,14-15H2,(H,26,32)(H,29,31) |
| InChIKey | VLIUIBXPEDFJRF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citarinostat (CHEBI:755707) has role antineoplastic agent (CHEBI:35610) |
| citarinostat (CHEBI:755707) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| INN | Source |
|---|---|
| citarinostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACY-241 | ChEMBL |
| HDAC-IN-2 | ChEMBL |
| Citations |
|---|