EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22Cl2FN5O3 |
| Net Charge | 0 |
| Average Mass | 506.365 |
| Monoisotopic Mass | 505.10837 |
| SMILES | Cc1cc(Nc2nc(CC3(C(=O)O)CCN(C(=O)c4cccc(Cl)c4Cl)CC3)ccc2F)nn1 |
| InChI | InChI=1S/C23H22Cl2FN5O3/c1-13-11-18(30-29-13)28-20-17(26)6-5-14(27-20)12-23(22(33)34)7-9-31(10-8-23)21(32)15-3-2-4-16(24)19(15)25/h2-6,11H,7-10,12H2,1H3,(H,33,34)(H2,27,28,29,30) |
| InChIKey | PLAVWQHGBMTMFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tas-119 (CHEBI:755706) has role antineoplastic agent (CHEBI:35610) |
| tas-119 (CHEBI:755706) is a N-acylpiperidine (CHEBI:48591) |
| Synonyms | Source |
|---|---|
| Tas 119 | ChEMBL |
| Tas-119 | ChEMBL |