EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H37N5O6 |
| Net Charge | 0 |
| Average Mass | 587.677 |
| Monoisotopic Mass | 587.27438 |
| SMILES | CNC(=O)n1ccc2cc(Oc3ccnc(NC(=O)c4ccc(C5CCN(CCO)CC5)cc4)c3)c(OCCOC)cc21 |
| InChI | InChI=1S/C32H37N5O6/c1-33-32(40)37-14-10-25-19-29(28(21-27(25)37)42-18-17-41-2)43-26-7-11-34-30(20-26)35-31(39)24-5-3-22(4-6-24)23-8-12-36(13-9-23)15-16-38/h3-7,10-11,14,19-21,23,38H,8-9,12-13,15-18H2,1-2H3,(H,33,40)(H,34,35,39) |
| InChIKey | IBHOLSBDZMIPPT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| e-7090 (CHEBI:755704) has role antineoplastic agent (CHEBI:35610) |
| e-7090 (CHEBI:755704) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| tasurgratinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| E 7090 | ChEMBL |
| E-7090 | ChEMBL |
| E7090 | ChEMBL |