EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25F3N4O3S |
| Net Charge | 0 |
| Average Mass | 506.550 |
| Monoisotopic Mass | 506.15995 |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cnc([C@@]3(O)CC[C@H](C(=O)O)C(C)(C)C3)s2)c1 |
| InChI | InChI=1S/C24H25F3N4O3S/c1-13-8-14(10-15(9-13)30-21-28-7-5-18(31-21)24(25,26)27)17-11-29-20(35-17)23(34)6-4-16(19(32)33)22(2,3)12-23/h5,7-11,16,34H,4,6,12H2,1-3H3,(H,32,33)(H,28,30,31)/t16-,23-/m1/s1 |
| InChIKey | LDDBKIFZPGDEND-WAIKUNEKSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-8457 (CHEBI:755703) has role antihypertensive agent (CHEBI:35674) |
| mk-8457 (CHEBI:755703) is a thiazoles (CHEBI:48901) |
| Synonym | Source |
|---|---|
| Mk-8457 | ChEMBL |