EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27FN4O5S |
| Net Charge | 0 |
| Average Mass | 526.590 |
| Monoisotopic Mass | 526.16862 |
| SMILES | O=C(c1nn(-c2ccc(CN3CCOCC3)cc2)c2c1CS(=O)(=O)c1c(F)cccc1-2)N1CCOCC1 |
| InChI | InChI=1S/C26H27FN4O5S/c27-22-3-1-2-20-24-21(17-37(33,34)25(20)22)23(26(32)30-10-14-36-15-11-30)28-31(24)19-6-4-18(5-7-19)16-29-8-12-35-13-9-29/h1-7H,8-17H2 |
| InChIKey | NFHSJYKXENYICE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roginolisib (CHEBI:755702) has role antifibrotic agent (CHEBI:233423) |
| roginolisib (CHEBI:755702) has role antineoplastic agent (CHEBI:35610) |
| roginolisib (CHEBI:755702) is a pyrazoles (CHEBI:26410) |
| roginolisib (CHEBI:755702) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| roginolisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ioa 244 | ChEMBL |
| IOA-244 | ChEMBL |
| IOA244 | ChEMBL |
| Msc-2360844 | ChEMBL |
| MSC2360844 | ChEMBL |
| Citations |
|---|