EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20FN3O5S |
| Net Charge | 0 |
| Average Mass | 445.472 |
| Monoisotopic Mass | 445.11077 |
| SMILES | Cc1onc(-c2ccc(F)cc2)c1COc1ccc(C(=O)N2CCS(=O)(=O)CC2)cn1 |
| InChI | InChI=1S/C21H20FN3O5S/c1-14-18(20(24-30-14)15-2-5-17(22)6-3-15)13-29-19-7-4-16(12-23-19)21(26)25-8-10-31(27,28)11-9-25/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | VCGRFBXVSFAGGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| basmisanil (CHEBI:755699) has role antipsychotic agent (CHEBI:35476) |
| basmisanil (CHEBI:755699) is a aromatic carboxylic acid (CHEBI:33859) |
| basmisanil (CHEBI:755699) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INN | Source |
|---|---|
| basmisanil | WHO MedNet |
| Synonyms | Source |
|---|---|
| RG-1662 | ChEMBL |
| RG1662 | ChEMBL |
| RO-5186582 | ChEMBL |
| RO5186582 | ChEMBL |
| RO5186582-000 | ChEMBL |
| Citations |
|---|