EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N9 |
| Net Charge | 0 |
| Average Mass | 443.559 |
| Monoisotopic Mass | 443.25459 |
| SMILES | CC(C)n1c(Nc2cccnc2)nc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C24H29N9/c1-17(2)33-22-21(29-24(33)28-19-5-4-10-25-15-19)16-26-23(30-22)27-18-6-8-20(9-7-18)32-13-11-31(3)12-14-32/h4-10,15-17H,11-14H2,1-3H3,(H,28,29)(H,26,27,30) |
| InChIKey | WSOHOUHPUOAXIN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ruserontinib (CHEBI:755697) has role antineoplastic agent (CHEBI:35610) |
| ruserontinib (CHEBI:755697) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| ruserontinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Sklb 1028 | ChEMBL |
| Sklb1028 | ChEMBL |
| SKLB-1028 | ChEMBL |