EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O2 |
| Net Charge | 0 |
| Average Mass | 278.396 |
| Monoisotopic Mass | 278.19943 |
| SMILES | CCCCOc1cccc(CCNCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-5-11-20-15-8-6-7-14(12-15)9-10-17-13-16(19)18(2)3/h6-8,12,17H,4-5,9-11,13H2,1-3H3 |
| InChIKey | GRHBODILPPXVKN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evenamide (CHEBI:755696) has role antipsychotic agent (CHEBI:35476) |
| evenamide (CHEBI:755696) is a amino acid amide (CHEBI:22475) |
| INNs | Source |
|---|---|
| evenamida | WHO MedNet |
| evenamide | WHO MedNet |
| Synonym | Source |
|---|---|
| Nw-3509 | ChEMBL |
| Citations |
|---|