EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N5O2 |
| Net Charge | 0 |
| Average Mass | 461.610 |
| Monoisotopic Mass | 461.27908 |
| SMILES | CC1(C)CC=C(c2nc(C3CC(C)(C)OC(C)(C)C3)ccc2NC(=O)c2ncc(C#N)n2)CC1 |
| InChI | InChI=1S/C27H35N5O2/c1-25(2)11-9-17(10-12-25)22-21(32-24(33)23-29-16-19(15-28)30-23)8-7-20(31-22)18-13-26(3,4)34-27(5,6)14-18/h7-9,16,18H,10-14H2,1-6H3,(H,29,30)(H,32,33) |
| InChIKey | BNVPFDRNGHMRJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edicotinib (CHEBI:755695) has role antineoplastic agent (CHEBI:35610) |
| edicotinib (CHEBI:755695) has role antirheumatic drug (CHEBI:35842) |
| edicotinib (CHEBI:755695) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| edicotinib | WHO MedNet |
| Synonym | Source |
|---|---|
| JNJ-40346527 | ChEMBL |
| Citations |
|---|