EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34ClN5O3 |
| Net Charge | 0 |
| Average Mass | 512.054 |
| Monoisotopic Mass | 511.23502 |
| SMILES | Cc1cc(C(=O)N(C)C)cc(NC(=O)[C@H]2CCC(=O)N2C2CCN(Cc3ccc(Cl)c(C)c3)CC2)n1 |
| InChI | InChI=1S/C27H34ClN5O3/c1-17-13-19(5-6-22(17)28)16-32-11-9-21(10-12-32)33-23(7-8-25(33)34)26(35)30-24-15-20(14-18(2)29-24)27(36)31(3)4/h5-6,13-15,21,23H,7-12,16H2,1-4H3,(H,29,30,35)/t23-/m1/s1 |
| InChIKey | DWKNOLCXIFYNFV-HSZRJFAPSA-N |
| Roles Classification |
|---|
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lazucirnon (CHEBI:755692) has role antiparkinson drug (CHEBI:48407) |
| lazucirnon (CHEBI:755692) has role ophthalmology drug (CHEBI:66981) |
| lazucirnon (CHEBI:755692) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| lazucirnon | WHO MedNet |
| Synonyms | Source |
|---|---|
| AKST-4290 | ChEMBL |
| AKST4290 | ChEMBL |
| ALK-429 | ChEMBL |
| ALK429 | ChEMBL |
| ALK-4290 | ChEMBL |
| ALK4290 | ChEMBL |