EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H70O5 |
| Net Charge | 0 |
| Average Mass | 618.984 |
| Monoisotopic Mass | 618.52233 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@@H](CO)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H70O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,37,40H,3-10,12,14-16,21-36H2,1-2H3/b13-11-,19-17-,20-18-/t37-/m1/s1 |
| InChIKey | FQNNBQJKEBDPQS-VCAYUJMESA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-linoleoyl-2-oleoyl-sn-glycerol (CHEBI:75569) is a 1-linoleoyl-2-oleoylglycerol (CHEBI:75614) |
| 3-linoleoyl-2-oleoyl-sn-glycerol (CHEBI:75569) is a 2,3-diacyl-sn-glycerol (CHEBI:75524) |
| 3-linoleoyl-2-oleoyl-sn-glycerol (CHEBI:75569) is enantiomer of 1-linoleoyl-2-oleoyl-sn-glycerol (CHEBI:75471) |
| Incoming Relation(s) |
| rac-1-linoleoyl-2-oleoylglycerol (CHEBI:75570) has part 3-linoleoyl-2-oleoyl-sn-glycerol (CHEBI:75569) |
| 1-linoleoyl-2-oleoyl-sn-glycerol (CHEBI:75471) is enantiomer of 3-linoleoyl-2-oleoyl-sn-glycerol (CHEBI:75569) |
| IUPAC Name |
|---|
| (2R)-3-hydroxy-2-[(9Z)-octadec-9-enoyloxy]propyl (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| 2-(9Z)-octadecenoyl-3-(9Z,12Z)-octadecadienoyl-sn-glycerol | SUBMITTER |
| 2-oleoyl-3-linoleoyl-sn-glycerol | ChEBI |
| DG (0:0/18:1(n-9)/18:2(n-6)) | SUBMITTER |
| sn-2-oleoyl-3-linoleoyl diglyceride | SUBMITTER |
| L-(+)-α-linoleoyl-β-oleoyl-glycerin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6590569 | Reaxys |