EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15F3N2O7S |
| Net Charge | 0 |
| Average Mass | 508.430 |
| Monoisotopic Mass | 508.05521 |
| SMILES | COc1cc(F)c(-n2c(=O)nc3csc(C(=O)O)c3c2=O)cc1OCc1c(OC)ccc(F)c1F |
| InChI | InChI=1S/C22H15F3N2O7S/c1-32-14-4-3-10(23)18(25)9(14)7-34-16-6-13(11(24)5-15(16)33-2)27-20(28)17-12(26-22(27)31)8-35-19(17)21(29)30/h3-6,8H,7H2,1-2H3,(H,26,31)(H,29,30) |
| InChIKey | BMAAMIIYNNPHAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linzagolix (CHEBI:755689) has role antineoplastic agent (CHEBI:35610) |
| linzagolix (CHEBI:755689) has role renoprotective agent (CHEBI:231911) |
| linzagolix (CHEBI:755689) is a thiophenecarboxylic acid (CHEBI:48436) |
| Synonyms | Source |
|---|---|
| KLH-2109 | ChEMBL |
| Linzagolix | ChEMBL |
| OBE-2109 | ChEMBL |
| OBE2109 | ChEMBL |