EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N8O3 |
| Net Charge | 0 |
| Average Mass | 562.719 |
| Monoisotopic Mass | 562.33799 |
| SMILES | C=CC(=O)N1CC[C@@H](Oc2nc(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)cc3)c(C(N)=O)nc2CC)C1 |
| InChI | InChI=1S/C30H42N8O3/c1-4-25-30(41-24-12-15-38(20-24)26(39)5-2)34-29(27(33-25)28(31)40)32-21-6-8-22(9-7-21)36-13-10-23(11-14-36)37-18-16-35(3)17-19-37/h5-9,23-24H,2,4,10-20H2,1,3H3,(H2,31,40)(H,32,34)/t24-/m1/s1 |
| InChIKey | QKDCLUARMDUUKN-XMMPIXPASA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naquotinib (CHEBI:755687) has role antineoplastic agent (CHEBI:35610) |
| naquotinib (CHEBI:755687) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| naquotinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| ASP-8273 | ChEMBL |
| ASP8273 | ChEMBL |
| Citations |
|---|