EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31N7O |
| Net Charge | 0 |
| Average Mass | 397.527 |
| Monoisotopic Mass | 397.25901 |
| SMILES | CC[C@H](Nc1nc(NCc2cnc(C)cc2C)c2ncn(C(C)C)c2n1)[C@@H](C)O |
| InChI | InChI=1S/C21H31N7O/c1-7-17(15(6)29)25-21-26-19(18-20(27-21)28(11-24-18)12(2)3)23-10-16-9-22-14(5)8-13(16)4/h8-9,11-12,15,17,29H,7,10H2,1-6H3,(H2,23,25,26,27)/t15-,17+/m1/s1 |
| InChIKey | DLPIYBKBHMZCJI-WBVHZDCISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyc-065 (CHEBI:755683) has role antineoplastic agent (CHEBI:35610) |
| cyc-065 (CHEBI:755683) is a purines (CHEBI:26401) |
| INN | Source |
|---|---|
| fadraciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cyc-065 | ChEMBL |
| Cyc065 | ChEMBL |
| Citations |
|---|