EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N5O2S |
| Net Charge | 0 |
| Average Mass | 323.422 |
| Monoisotopic Mass | 323.14160 |
| SMILES | CCCS(=O)(=O)N[C@H]1C[C@@H](N(C)c2ncnc3nccc23)C1 |
| InChI | InChI=1S/C14H21N5O2S/c1-3-6-22(20,21)18-10-7-11(8-10)19(2)14-12-4-5-15-13(12)16-9-17-14/h4-5,9-11,18H,3,6-8H2,1-2H3,(H,15,16,17)/t10-,11+ |
| InChIKey | IUEWXNHSKRWHDY-PHIMTYICSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antipsoriatic A drug used to treat psoriasis. renoprotective agent Any compound that is able to prevent damage to the kidneys. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abrocitinib (CHEBI:755682) has role antipsoriatic (CHEBI:50748) |
| abrocitinib (CHEBI:755682) has role dermatologic drug (CHEBI:50177) |
| abrocitinib (CHEBI:755682) has role hypoglycemic agent (CHEBI:35526) |
| abrocitinib (CHEBI:755682) has role renoprotective agent (CHEBI:231911) |
| abrocitinib (CHEBI:755682) is a pyrrolopyrimidine (CHEBI:38670) |
| Synonyms | Source |
|---|---|
| Abrocitinib | ChEMBL |
| Cibinqo | ChEMBL |
| PF-04965842 | ChEMBL |
| Citations |
|---|