EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24Cl2N6O4 |
| Net Charge | 0 |
| Average Mass | 555.422 |
| Monoisotopic Mass | 554.12361 |
| SMILES | COc1ncc(-c2nc3c(n2C(C)C)[C@H](c2ccc(Cl)cc2)N(c2cc(Cl)cn(C)c2=O)C3=O)c(OC)n1 |
| InChI | InChI=1S/C26H24Cl2N6O4/c1-13(2)33-21-19(30-22(33)17-11-29-26(38-5)31-23(17)37-4)25(36)34(18-10-16(28)12-32(3)24(18)35)20(21)14-6-8-15(27)9-7-14/h6-13,20H,1-5H3/t20-/m0/s1 |
| InChIKey | AGBSXNCBIWWLHD-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| siremadlin (CHEBI:755680) has role antifibrotic agent (CHEBI:233423) |
| siremadlin (CHEBI:755680) has role antineoplastic agent (CHEBI:35610) |
| siremadlin (CHEBI:755680) is a chloropyridine (CHEBI:39173) |
| INNs | Source |
|---|---|
| siremadlin | WHO MedNet |
| siremadlina | WHO MedNet |
| siremadline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Hdm 201 | ChEMBL |
| HDM-201 | ChEMBL |
| HDM201 | ChEMBL |
| NVP-HDM 201 | ChEMBL |
| Citations |
|---|