EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755678 - lgh-447
| Formula | C24H23F3N4O |
| Net Charge | 0 |
| Average Mass | 440.469 |
| Monoisotopic Mass | 440.18240 |
| SMILES | C[C@@H]1C[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C1 |
| InChI | InChI=1S/C24H23F3N4O/c1-13-9-14(11-15(28)10-13)16-7-8-29-12-21(16)31-24(32)20-6-5-19(27)23(30-20)22-17(25)3-2-4-18(22)26/h2-8,12-15H,9-11,28H2,1H3,(H,31,32)/t13-,14+,15-/m0/s1 |
| InChIKey | VRQXRVAKPDCRCI-ZNMIVQPWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lgh-447 (CHEBI:755678) has role antifibrotic agent (CHEBI:233423) |
| lgh-447 (CHEBI:755678) has role antineoplastic agent (CHEBI:35610) |
| lgh-447 (CHEBI:755678) is a aromatic carboxylic acid (CHEBI:33859) |
| lgh-447 (CHEBI:755678) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| LGH-447 | ChEMBL |
| LGH447 | ChEMBL |
| NVP-LGH477 | ChEMBL |
| PIM 447 | ChEMBL |
| PIM-447 | ChEMBL |
| PIM447 | ChEMBL |
| Citations |
|---|